C13H15F2NO5S — CID 119248261
2-[4-[3-(difluoromethoxy)-5-methylthiophene-2-carbonyl]morpholin-2-yl]acetic acid (PubChem CID 119248261) has the molecular formula C13H15F2NO5S and a molecular weight of 335.33 g/mol. Its IUPAC name is 2-[4-[3-(difluoromethoxy)-5-methylthiophene-2-carbonyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[3-(difluoromethoxy)-5-methylthiophene-2-carbonyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 119248261 |
| Molecular Formula | C13H15F2NO5S |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-[4-[3-(difluoromethoxy)-5-methylthiophene-2-carbonyl]morpholin-2-yl]acetic acid |
| SMILES | Cc1cc(OC(F)F)c(C(=O)N2CCOC(CC(=O)O)C2)s1 |
| InChI | InChI=1S/C13H15F2NO5S/c1-7-4-9(21-13(14)15)11(22-7)12(19)16-2-3-20-8(6-16)5-10(17)18/h4,8,13H,2-3,5-6H2,1H3,(H,17,18) |
| InChIKey | HQKGIGBYEQRJMB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |