About 5-[[2-(3,4-dihydro-1H-isochromen-1-yl)acetyl]amino]-2-methylbenzoic acid
5-[[2-(3,4-dihydro-1H-isochromen-1-yl)acetyl]amino]-2-methylbenzoic acid (PubChem CID 119255126) has the molecular formula C19H19NO4
and a molecular weight of 325.36 g/mol. Its IUPAC name is 5-[[2-(3,4-dihydro-1H-isochromen-1-yl)acetyl]amino]-2-methylbenzoic acid.
Molecular Properties
| Compound Name | 5-[[2-(3,4-dihydro-1H-isochromen-1-yl)acetyl]amino]-2-methylbenzoic acid |
| PubChem CID | 119255126 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 5-[[2-(3,4-dihydro-1H-isochromen-1-yl)acetyl]amino]-2-methylbenzoic acid |
| SMILES | Cc1ccc(NC(=O)CC2OCCc3ccccc32)cc1C(=O)O |
| InChI | InChI=1S/C19H19NO4/c1-12-6-7-14(10-16(12)19(22)23)20-18(21)11-17-15-5-3-2-4-13(15)8-9-24-17/h2-7,10,17H,8-9,11H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | DCIXMDUXLDRUDV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[[2-(3,4-dihydro-1H-isochromen-1-yl)acetyl]amino]-2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[2-(3,4-dihydro-1H-isochromen-1-yl)acetyl]amino]-2-methylbenzoic acid?
The IUPAC name of 5-[[2-(3,4-dihydro-1H-isochromen-1-yl)acetyl]amino]-2-methylbenzoic acid (CID 119255126) is 5-[[2-(3,4-dihydro-1H-isochromen-1-yl)acetyl]amino]-2-methylbenzoic acid.
What is the SMILES notation for 5-[[2-(3,4-dihydro-1H-isochromen-1-yl)acetyl]amino]-2-methylbenzoic acid?
The canonical SMILES for 5-[[2-(3,4-dihydro-1H-isochromen-1-yl)acetyl]amino]-2-methylbenzoic acid is Cc1ccc(NC(=O)CC2OCCc3ccccc32)cc1C(=O)O.
What is the InChIKey of 5-[[2-(3,4-dihydro-1H-isochromen-1-yl)acetyl]amino]-2-methylbenzoic acid?
The InChIKey is DCIXMDUXLDRUDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO4/c1-12-6-7-14(10-16(12)19(22)23)20-18(21)11-17-15-5-3-2-4-13(15)8-9-24-17/h2-7,10,17H,8-9,11H2,1H3,(H,20,21)(H,22,23).
What are the key properties of 5-[[2-(3,4-dihydro-1H-isochromen-1-yl)acetyl]amino]-2-methylbenzoic acid?
5-[[2-(3,4-dihydro-1H-isochromen-1-yl)acetyl]amino]-2-methylbenzoic acid has a molecular weight of 325.36 g/mol, XLogP of 3.34, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[2-(3,4-dihydro-1H-isochromen-1-yl)acetyl]amino]-2-methylbenzoic acid is sourced from PubChem (CID 119255126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).