C19H19NO5 — CID 75392069
methyl 4-[[2-(3,4-dihydro-1H-isochromen-1-yl)acetyl]amino]-3-hydroxybenzoate (PubChem CID 75392069) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is methyl 4-[[2-(3,4-dihydro-1H-isochromen-1-yl)acetyl]amino]-3-hydroxybenzoate.
| Compound Name | methyl 4-[[2-(3,4-dihydro-1H-isochromen-1-yl)acetyl]amino]-3-hydroxybenzoate |
|---|---|
| PubChem CID | 75392069 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | methyl 4-[[2-(3,4-dihydro-1H-isochromen-1-yl)acetyl]amino]-3-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CC2OCCc3ccccc32)c(O)c1 |
| InChI | InChI=1S/C19H19NO5/c1-24-19(23)13-6-7-15(16(21)10-13)20-18(22)11-17-14-5-3-2-4-12(14)8-9-25-17/h2-7,10,17,21H,8-9,11H2,1H3,(H,20,22) |
| InChIKey | PUBGTKMMHKJWCJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|