C24H23NO2 — CID 97082587
N-(2-benzylphenyl)-2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]acetamide (PubChem CID 97082587) has the molecular formula C24H23NO2 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-(2-benzylphenyl)-2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]acetamide.
| Compound Name | N-(2-benzylphenyl)-2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]acetamide |
|---|---|
| PubChem CID | 97082587 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-(2-benzylphenyl)-2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]acetamide |
| SMILES | O=C(C[C@@H]1OCCc2ccccc21)Nc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C24H23NO2/c26-24(17-23-21-12-6-4-10-19(21)14-15-27-23)25-22-13-7-5-11-20(22)16-18-8-2-1-3-9-18/h1-13,23H,14-17H2,(H,25,26)/t23-/m0/s1 |
| InChIKey | QDPQWVMFNKPLIF-QHCPKHFHSA-N |
| XLogP | 4.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |