C22H32N4O3 — CID 11925986
N-[2-(N-ethyl-3-methylanilino)ethyl]-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 11925986) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is N-[2-(N-ethyl-3-methylanilino)ethyl]-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-[2-(N-ethyl-3-methylanilino)ethyl]-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 11925986 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | N-[2-(N-ethyl-3-methylanilino)ethyl]-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | CCN(CCNC(=O)CN1C(=O)N[C@]2(CCCC[C@@H]2C)C1=O)c1cccc(C)c1 |
| InChI | InChI=1S/C22H32N4O3/c1-4-25(18-10-7-8-16(2)14-18)13-12-23-19(27)15-26-20(28)22(24-21(26)29)11-6-5-9-17(22)3/h7-8,10,14,17H,4-6,9,11-13,15H2,1-3H3,(H,23,27)(H,24,29)/t17-,22-/m0/s1 |
| InChIKey | DMRRAWCZRJUNQG-JTSKRJEESA-N |
| XLogP | 2.44 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|