C23H33N3O4 — CID 51585025
2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]acetamide (PubChem CID 51585025) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is 2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]acetamide.
| Compound Name | 2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 51585025 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]acetamide |
| SMILES | Cc1ccc(C(C)C)c(OCCNC(=O)CN2C(=O)N[C@@]3(CCCC[C@H]3C)C2=O)c1 |
| InChI | InChI=1S/C23H33N3O4/c1-15(2)18-9-8-16(3)13-19(18)30-12-11-24-20(27)14-26-21(28)23(25-22(26)29)10-6-5-7-17(23)4/h8-9,13,15,17H,5-7,10-12,14H2,1-4H3,(H,24,27)(H,25,29)/t17-,23-/m1/s1 |
| InChIKey | RFVYAHAEOWIJMR-UZUQRXQVSA-N |
| XLogP | 3.11 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|