C11H20ClN3O2S — CID 119262243
N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3-thiazolidine-4-carboxamide;hydrochloride (PubChem CID 119262243) has the molecular formula C11H20ClN3O2S and a molecular weight of 293.82 g/mol. Its IUPAC name is N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3-thiazolidine-4-carboxamide;hydrochloride.
| Compound Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3-thiazolidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119262243 |
| Molecular Formula | C11H20ClN3O2S |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3-thiazolidine-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCCN1CCCC1=O)C1CSCN1 |
| InChI | InChI=1S/C11H19N3O2S.ClH/c15-10-3-1-5-14(10)6-2-4-12-11(16)9-7-17-8-13-9;/h9,13H,1-8H2,(H,12,16);1H |
| InChIKey | HYJYKOBXUOYVPG-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|