C22H25N3OS — CID 11926368
2-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-6-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 11926368) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is 2-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-6-phenyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-6-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 11926368 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 2-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-6-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CN2CC[C@@H]3CCCC[C@@H]3C2)nc2sc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C22H25N3OS/c26-21-18-12-19(16-7-2-1-3-8-16)27-22(18)24-20(23-21)14-25-11-10-15-6-4-5-9-17(15)13-25/h1-3,7-8,12,15,17H,4-6,9-11,13-14H2,(H,23,24,26)/t15-,17+/m0/s1 |
| InChIKey | JIGRSGHUWHGBCZ-DOTOQJQBSA-N |
| XLogP | 4.66 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |