C20H23N3O2S — CID 11933253
2-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-5-(furan-2-yl)-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 11933253) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is 2-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-5-(furan-2-yl)-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-5-(furan-2-yl)-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 11933253 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-5-(furan-2-yl)-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CN2CC[C@@H]3CCCC[C@@H]3C2)nc2scc(-c3ccco3)c12 |
| InChI | InChI=1S/C20H23N3O2S/c24-19-18-15(16-6-3-9-25-16)12-26-20(18)22-17(21-19)11-23-8-7-13-4-1-2-5-14(13)10-23/h3,6,9,12-14H,1-2,4-5,7-8,10-11H2,(H,21,22,24)/t13-,14+/m0/s1 |
| InChIKey | PKDBHVATAJHPJR-UONOGXRCSA-N |
| XLogP | 4.26 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |