C22H24FN3OS — CID 9023153
2-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-5-(4-fluorophenyl)-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 9023153) has the molecular formula C22H24FN3OS and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-5-(4-fluorophenyl)-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-5-(4-fluorophenyl)-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 9023153 |
| Molecular Formula | C22H24FN3OS |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-5-(4-fluorophenyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CN2CC[C@H]3CCCC[C@H]3C2)nc2scc(-c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C22H24FN3OS/c23-17-7-5-15(6-8-17)18-13-28-22-20(18)21(27)24-19(25-22)12-26-10-9-14-3-1-2-4-16(14)11-26/h5-8,13-14,16H,1-4,9-12H2,(H,24,25,27)/t14-,16+/m1/s1 |
| InChIKey | RKHJKQOCOWWYKD-ZBFHGGJFSA-N |
| XLogP | 4.80 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |