C23H23N3O5 — CID 11927706
[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 2-[(1R)-2-acetyl-1H-isoquinolin-1-yl]acetate (PubChem CID 11927706) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 2-[(1R)-2-acetyl-1H-isoquinolin-1-yl]acetate.
| Compound Name | [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 2-[(1R)-2-acetyl-1H-isoquinolin-1-yl]acetate |
|---|---|
| PubChem CID | 11927706 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 2-[(1R)-2-acetyl-1H-isoquinolin-1-yl]acetate |
| SMILES | CNC(=O)c1ccc(NC(=O)COC(=O)C[C@@H]2c3ccccc3C=CN2C(C)=O)cc1 |
| InChI | InChI=1S/C23H23N3O5/c1-15(27)26-12-11-16-5-3-4-6-19(16)20(26)13-22(29)31-14-21(28)25-18-9-7-17(8-10-18)23(30)24-2/h3-12,20H,13-14H2,1-2H3,(H,24,30)(H,25,28)/t20-/m1/s1 |
| InChIKey | GLGBLAOBVCZOAI-HXUWFJFHSA-N |
| XLogP | 2.49 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |