C18H19N4O3S+ — CID 11928185
2-(4-nitrophenyl)-5-[(1R)-1-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]ethyl]-1,3,4-oxadiazole (PubChem CID 11928185) has the molecular formula C18H19N4O3S+ and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-5-[(1R)-1-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]ethyl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-nitrophenyl)-5-[(1R)-1-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]ethyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 11928185 |
| Molecular Formula | C18H19N4O3S+ |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-(4-nitrophenyl)-5-[(1R)-1-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]ethyl]-1,3,4-oxadiazole |
| SMILES | C[C@H](c1nnc(-c2ccc([N+](=O)[O-])cc2)o1)[NH+]1CCC[C@@H]1c1cccs1 |
| InChI | InChI=1S/C18H18N4O3S/c1-12(21-10-2-4-15(21)16-5-3-11-26-16)17-19-20-18(25-17)13-6-8-14(9-7-13)22(23)24/h3,5-9,11-12,15H,2,4,10H2,1H3/p+1/t12-,15-/m1/s1 |
| InChIKey | JILRPVMLEPMRLZ-IUODEOHRSA-O |
| XLogP | 3.19 |
| TPSA | 86.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|