C11H18ClF3N2O — CID 119303351
N-prop-2-enyl-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide;hydrochloride (PubChem CID 119303351) has the molecular formula C11H18ClF3N2O and a molecular weight of 286.72 g/mol. Its IUPAC name is N-prop-2-enyl-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | N-prop-2-enyl-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119303351 |
| Molecular Formula | C11H18ClF3N2O |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N-prop-2-enyl-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide;hydrochloride |
| SMILES | C=CCN(CC(F)(F)F)C(=O)C1CCNCC1.Cl |
| InChI | InChI=1S/C11H17F3N2O.ClH/c1-2-7-16(8-11(12,13)14)10(17)9-3-5-15-6-4-9;/h2,9,15H,1,3-8H2;1H |
| InChIKey | DERFNLOYVRASGU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|