C21H33N3O3S — CID 11931064
2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N-[4-(diethylsulfamoyl)phenyl]acetamide (PubChem CID 11931064) has the molecular formula C21H33N3O3S and a molecular weight of 407.58 g/mol. Its IUPAC name is 2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N-[4-(diethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N-[4-(diethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 11931064 |
| Molecular Formula | C21H33N3O3S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N-[4-(diethylsulfamoyl)phenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)CN2CCC[C@H]3CCCC[C@@H]32)cc1 |
| InChI | InChI=1S/C21H33N3O3S/c1-3-24(4-2)28(26,27)19-13-11-18(12-14-19)22-21(25)16-23-15-7-9-17-8-5-6-10-20(17)23/h11-14,17,20H,3-10,15-16H2,1-2H3,(H,22,25)/t17-,20+/m1/s1 |
| InChIKey | QHQTXLYSIXSAEX-XLIONFOSSA-N |
| XLogP | 3.31 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |