C17H21ClN2OS — CID 119314158
N-phenyl-N-(thiophen-3-ylmethyl)piperidine-4-carboxamide;hydrochloride (PubChem CID 119314158) has the molecular formula C17H21ClN2OS and a molecular weight of 336.89 g/mol. Its IUPAC name is N-phenyl-N-(thiophen-3-ylmethyl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | N-phenyl-N-(thiophen-3-ylmethyl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119314158 |
| Molecular Formula | C17H21ClN2OS |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-phenyl-N-(thiophen-3-ylmethyl)piperidine-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(C1CCNCC1)N(Cc1ccsc1)c1ccccc1 |
| InChI | InChI=1S/C17H20N2OS.ClH/c20-17(15-6-9-18-10-7-15)19(12-14-8-11-21-13-14)16-4-2-1-3-5-16;/h1-5,8,11,13,15,18H,6-7,9-10,12H2;1H |
| InChIKey | ATMOWGSTDWGWMN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |