C20H23N5OS — CID 119767433
5-methyl-N-phenyl-1-piperidin-4-yl-N-(thiophen-3-ylmethyl)triazole-4-carboxamide (PubChem CID 119767433) has the molecular formula C20H23N5OS and a molecular weight of 381.50 g/mol. Its IUPAC name is 5-methyl-N-phenyl-1-piperidin-4-yl-N-(thiophen-3-ylmethyl)triazole-4-carboxamide.
| Compound Name | 5-methyl-N-phenyl-1-piperidin-4-yl-N-(thiophen-3-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 119767433 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 5-methyl-N-phenyl-1-piperidin-4-yl-N-(thiophen-3-ylmethyl)triazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N(Cc2ccsc2)c2ccccc2)nnn1C1CCNCC1 |
| InChI | InChI=1S/C20H23N5OS/c1-15-19(22-23-25(15)18-7-10-21-11-8-18)20(26)24(13-16-9-12-27-14-16)17-5-3-2-4-6-17/h2-6,9,12,14,18,21H,7-8,10-11,13H2,1H3 |
| InChIKey | ZYXCULRKJMCSKM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |