C20H30ClN5O — CID 119688822
N-benzyl-N-butan-2-yl-5-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119688822) has the molecular formula C20H30ClN5O and a molecular weight of 391.95 g/mol. Its IUPAC name is N-benzyl-N-butan-2-yl-5-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-benzyl-N-butan-2-yl-5-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119688822 |
| Molecular Formula | C20H30ClN5O |
| Molecular Weight | 391.95 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | N-benzyl-N-butan-2-yl-5-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | CCC(C)N(Cc1ccccc1)C(=O)c1nnn(C2CCNCC2)c1C.Cl |
| InChI | InChI=1S/C20H29N5O.ClH/c1-4-15(2)24(14-17-8-6-5-7-9-17)20(26)19-16(3)25(23-22-19)18-10-12-21-13-11-18;/h5-9,15,18,21H,4,10-14H2,1-3H3;1H |
| InChIKey | FSJBCDWRKDFDSU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.95 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |