C16H29N5O — CID 119730921
5-methyl-N-(2-methylpropyl)-1-piperidin-4-yl-N-propan-2-yltriazole-4-carboxamide (PubChem CID 119730921) has the molecular formula C16H29N5O and a molecular weight of 307.44 g/mol. Its IUPAC name is 5-methyl-N-(2-methylpropyl)-1-piperidin-4-yl-N-propan-2-yltriazole-4-carboxamide.
| Compound Name | 5-methyl-N-(2-methylpropyl)-1-piperidin-4-yl-N-propan-2-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119730921 |
| Molecular Formula | C16H29N5O |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.24 |
| IUPAC Name | 5-methyl-N-(2-methylpropyl)-1-piperidin-4-yl-N-propan-2-yltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N(CC(C)C)C(C)C)nnn1C1CCNCC1 |
| InChI | InChI=1S/C16H29N5O/c1-11(2)10-20(12(3)4)16(22)15-13(5)21(19-18-15)14-6-8-17-9-7-14/h11-12,14,17H,6-10H2,1-5H3 |
| InChIKey | DEGGMODXHOGLDI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |