C22H34ClN5O — CID 119783777
N-butyl-5-methyl-N-(1-phenylpropyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119783777) has the molecular formula C22H34ClN5O and a molecular weight of 420.00 g/mol. Its IUPAC name is N-butyl-5-methyl-N-(1-phenylpropyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-butyl-5-methyl-N-(1-phenylpropyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119783777 |
| Molecular Formula | C22H34ClN5O |
| Molecular Weight | 420.00 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | N-butyl-5-methyl-N-(1-phenylpropyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | CCCCN(C(=O)c1nnn(C2CCNCC2)c1C)C(CC)c1ccccc1.Cl |
| InChI | InChI=1S/C22H33N5O.ClH/c1-4-6-16-26(20(5-2)18-10-8-7-9-11-18)22(28)21-17(3)27(25-24-21)19-12-14-23-15-13-19;/h7-11,19-20,23H,4-6,12-16H2,1-3H3;1H |
| InChIKey | ZFMIUPATVPDLHV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.00 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |