C19H22ClN5OS — CID 119767436
N-phenyl-1-piperidin-4-yl-N-(thiophen-3-ylmethyl)triazole-4-carboxamide;hydrochloride (PubChem CID 119767436) has the molecular formula C19H22ClN5OS and a molecular weight of 403.94 g/mol. Its IUPAC name is N-phenyl-1-piperidin-4-yl-N-(thiophen-3-ylmethyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | N-phenyl-1-piperidin-4-yl-N-(thiophen-3-ylmethyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119767436 |
| Molecular Formula | C19H22ClN5OS |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-phenyl-1-piperidin-4-yl-N-(thiophen-3-ylmethyl)triazole-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(c1cn(C2CCNCC2)nn1)N(Cc1ccsc1)c1ccccc1 |
| InChI | InChI=1S/C19H21N5OS.ClH/c25-19(18-13-24(22-21-18)17-6-9-20-10-7-17)23(12-15-8-11-26-14-15)16-4-2-1-3-5-16;/h1-5,8,11,13-14,17,20H,6-7,9-10,12H2;1H |
| InChIKey | KKFRJZQUUDXKIL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |