C21H25NO5 — CID 11932253
[(2R)-1-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 2-oxochromene-3-carboxylate (PubChem CID 11932253) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is [(2R)-1-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 2-oxochromene-3-carboxylate.
| Compound Name | [(2R)-1-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 11932253 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [(2R)-1-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 2-oxochromene-3-carboxylate |
| SMILES | C[C@H]1[C@@H](NC(=O)[C@@H](C)OC(=O)c2cc3ccccc3oc2=O)CCC[C@@H]1C |
| InChI | InChI=1S/C21H25NO5/c1-12-7-6-9-17(13(12)2)22-19(23)14(3)26-20(24)16-11-15-8-4-5-10-18(15)27-21(16)25/h4-5,8,10-14,17H,6-7,9H2,1-3H3,(H,22,23)/t12-,13+,14+,17-/m0/s1 |
| InChIKey | UIVQZLZLSMWKNF-CFAJVAMVSA-N |
| XLogP | 3.28 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|