C19H23N3O3S — CID 11946375
1-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-[(2-oxochromene-3-carbonyl)amino]thiourea (PubChem CID 11946375) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is 1-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-[(2-oxochromene-3-carbonyl)amino]thiourea.
| Compound Name | 1-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-[(2-oxochromene-3-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 11946375 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-[(2-oxochromene-3-carbonyl)amino]thiourea |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@H]1NC(=S)NNC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C19H23N3O3S/c1-11-6-5-8-15(12(11)2)20-19(26)22-21-17(23)14-10-13-7-3-4-9-16(13)25-18(14)24/h3-4,7,9-12,15H,5-6,8H2,1-2H3,(H,21,23)(H2,20,22,26)/t11-,12+,15+/m0/s1 |
| InChIKey | XFBBMHNZTYWJTR-YWPYICTPSA-N |
| XLogP | 2.73 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|