C22H28N2O3 — CID 119325168
methyl 2-[[(1-aminocyclohexanecarbonyl)amino]methyl]-3-naphthalen-2-ylpropanoate (PubChem CID 119325168) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is methyl 2-[[(1-aminocyclohexanecarbonyl)amino]methyl]-3-naphthalen-2-ylpropanoate.
| Compound Name | methyl 2-[[(1-aminocyclohexanecarbonyl)amino]methyl]-3-naphthalen-2-ylpropanoate |
|---|---|
| PubChem CID | 119325168 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | methyl 2-[[(1-aminocyclohexanecarbonyl)amino]methyl]-3-naphthalen-2-ylpropanoate |
| SMILES | COC(=O)C(CNC(=O)C1(N)CCCCC1)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H28N2O3/c1-27-20(25)19(15-24-21(26)22(23)11-5-2-6-12-22)14-16-9-10-17-7-3-4-8-18(17)13-16/h3-4,7-10,13,19H,2,5-6,11-12,14-15,23H2,1H3,(H,24,26) |
| InChIKey | XSXLRPZELPRIIJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |