C19H22F2N2O3S — CID 119338392
2-amino-N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]pentanamide (PubChem CID 119338392) has the molecular formula C19H22F2N2O3S and a molecular weight of 396.46 g/mol. Its IUPAC name is 2-amino-N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]pentanamide.
| Compound Name | 2-amino-N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 119338392 |
| Molecular Formula | C19H22F2N2O3S |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-amino-N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]pentanamide |
| SMILES | CCCC(N)C(=O)NC(c1cccc(S(C)(=O)=O)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H22F2N2O3S/c1-3-5-17(22)19(24)23-18(13-8-9-15(20)16(21)11-13)12-6-4-7-14(10-12)27(2,25)26/h4,6-11,17-18H,3,5,22H2,1-2H3,(H,23,24) |
| InChIKey | NUJCVWQPWCATAO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |