C21H28N2O3S — CID 120563127
4-amino-N-[(4-ethylphenyl)-(3-methylsulfonylphenyl)methyl]pentanamide (PubChem CID 120563127) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is 4-amino-N-[(4-ethylphenyl)-(3-methylsulfonylphenyl)methyl]pentanamide.
| Compound Name | 4-amino-N-[(4-ethylphenyl)-(3-methylsulfonylphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 120563127 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 4-amino-N-[(4-ethylphenyl)-(3-methylsulfonylphenyl)methyl]pentanamide |
| SMILES | CCc1ccc(C(NC(=O)CCC(C)N)c2cccc(S(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C21H28N2O3S/c1-4-16-9-11-17(12-10-16)21(23-20(24)13-8-15(2)22)18-6-5-7-19(14-18)27(3,25)26/h5-7,9-12,14-15,21H,4,8,13,22H2,1-3H3,(H,23,24) |
| InChIKey | BZCPHLGRJADYGZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |