C16H29ClN2OS — CID 119342676
2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-(2-propan-2-ylthiomorpholin-4-yl)methanone;hydrochloride (PubChem CID 119342676) has the molecular formula C16H29ClN2OS and a molecular weight of 332.94 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-(2-propan-2-ylthiomorpholin-4-yl)methanone;hydrochloride.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-(2-propan-2-ylthiomorpholin-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119342676 |
| Molecular Formula | C16H29ClN2OS |
| Molecular Weight | 332.94 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-(2-propan-2-ylthiomorpholin-4-yl)methanone;hydrochloride |
| SMILES | CC(C)C1CN(C(=O)C2CC3CCCCC3N2)CCS1.Cl |
| InChI | InChI=1S/C16H28N2OS.ClH/c1-11(2)15-10-18(7-8-20-15)16(19)14-9-12-5-3-4-6-13(12)17-14;/h11-15,17H,3-10H2,1-2H3;1H |
| InChIKey | GNLLTDDSRLKIMM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.94 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |