C14H24N4O3 — CID 119345899
ethyl 2-[4-[[(2S)-2-amino-3-methylbutanoyl]amino]pyrazol-1-yl]-2-methylpropanoate (PubChem CID 119345899) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is ethyl 2-[4-[[(2S)-2-amino-3-methylbutanoyl]amino]pyrazol-1-yl]-2-methylpropanoate.
| Compound Name | ethyl 2-[4-[[(2S)-2-amino-3-methylbutanoyl]amino]pyrazol-1-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 119345899 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | ethyl 2-[4-[[(2S)-2-amino-3-methylbutanoyl]amino]pyrazol-1-yl]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)n1cc(NC(=O)[C@@H](N)C(C)C)cn1 |
| InChI | InChI=1S/C14H24N4O3/c1-6-21-13(20)14(4,5)18-8-10(7-16-18)17-12(19)11(15)9(2)3/h7-9,11H,6,15H2,1-5H3,(H,17,19)/t11-/m0/s1 |
| InChIKey | YMRCYLPYDCVUKW-NSHDSACASA-N |
| XLogP | 1.10 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |