C18H22ClN3O — CID 11935296
(2S)-N-(4-chlorophenyl)-2-[(2R)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-yl]propanamide (PubChem CID 11935296) has the molecular formula C18H22ClN3O and a molecular weight of 331.85 g/mol. Its IUPAC name is (2S)-N-(4-chlorophenyl)-2-[(2R)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-yl]propanamide.
| Compound Name | (2S)-N-(4-chlorophenyl)-2-[(2R)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 11935296 |
| Molecular Formula | C18H22ClN3O |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | (2S)-N-(4-chlorophenyl)-2-[(2R)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(Cl)cc1)N1CCC[C@@H]1c1cccn1C |
| InChI | InChI=1S/C18H22ClN3O/c1-13(18(23)20-15-9-7-14(19)8-10-15)22-12-4-6-17(22)16-5-3-11-21(16)2/h3,5,7-11,13,17H,4,6,12H2,1-2H3,(H,20,23)/t13-,17+/m0/s1 |
| InChIKey | LMAVJHYLYKLFRN-SUMWQHHRSA-N |
| XLogP | 3.84 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |