C12H13F2NO5S — CID 119359231
2-[[4-(difluoromethylsulfonyl)benzoyl]-methylamino]propanoic acid (PubChem CID 119359231) has the molecular formula C12H13F2NO5S and a molecular weight of 321.30 g/mol. Its IUPAC name is 2-[[4-(difluoromethylsulfonyl)benzoyl]-methylamino]propanoic acid.
| Compound Name | 2-[[4-(difluoromethylsulfonyl)benzoyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 119359231 |
| Molecular Formula | C12H13F2NO5S |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2-[[4-(difluoromethylsulfonyl)benzoyl]-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C12H13F2NO5S/c1-7(11(17)18)15(2)10(16)8-3-5-9(6-4-8)21(19,20)12(13)14/h3-7,12H,1-2H3,(H,17,18) |
| InChIKey | PTDOEWWTDYZRMH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |