C17H17F2NO4S — CID 78880908
4-[[4-(difluoromethylsulfonyl)phenyl]methoxy]-N,N-dimethylbenzamide (PubChem CID 78880908) has the molecular formula C17H17F2NO4S and a molecular weight of 369.39 g/mol. Its IUPAC name is 4-[[4-(difluoromethylsulfonyl)phenyl]methoxy]-N,N-dimethylbenzamide.
| Compound Name | 4-[[4-(difluoromethylsulfonyl)phenyl]methoxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 78880908 |
| Molecular Formula | C17H17F2NO4S |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 4-[[4-(difluoromethylsulfonyl)phenyl]methoxy]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(OCc2ccc(S(=O)(=O)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H17F2NO4S/c1-20(2)16(21)13-5-7-14(8-6-13)24-11-12-3-9-15(10-4-12)25(22,23)17(18)19/h3-10,17H,11H2,1-2H3 |
| InChIKey | HEACMVOHYFWWHA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |