C16H17FN2O4 — CID 177004804
4-[[4-[fluoro(hydroxy)amino]oxyphenoxy]methyl]-N,N-dimethylbenzamide (PubChem CID 177004804) has the molecular formula C16H17FN2O4 and a molecular weight of 320.32 g/mol. Its IUPAC name is 4-[[4-[fluoro(hydroxy)amino]oxyphenoxy]methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[[4-[fluoro(hydroxy)amino]oxyphenoxy]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 177004804 |
| Molecular Formula | C16H17FN2O4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 4-[[4-[fluoro(hydroxy)amino]oxyphenoxy]methyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(COc2ccc(ON(O)F)cc2)cc1 |
| InChI | InChI=1S/C16H17FN2O4/c1-18(2)16(20)13-5-3-12(4-6-13)11-22-14-7-9-15(10-8-14)23-19(17)21/h3-10,21H,11H2,1-2H3 |
| InChIKey | QZDKDZRWQAFBLC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|