About (2S)-2-[[1-(1,3-benzoxazol-2-yl)piperidine-4-carbonyl]amino]-3-methylbutanoic acid
(2S)-2-[[1-(1,3-benzoxazol-2-yl)piperidine-4-carbonyl]amino]-3-methylbutanoic acid (PubChem CID 119359710) has the molecular formula C18H23N3O4
and a molecular weight of 345.40 g/mol. Its IUPAC name is (2S)-2-[[1-(1,3-benzoxazol-2-yl)piperidine-4-carbonyl]amino]-3-methylbutanoic acid.
Molecular Properties
| Compound Name | (2S)-2-[[1-(1,3-benzoxazol-2-yl)piperidine-4-carbonyl]amino]-3-methylbutanoic acid |
| PubChem CID | 119359710 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (2S)-2-[[1-(1,3-benzoxazol-2-yl)piperidine-4-carbonyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)C1CCN(c2nc3ccccc3o2)CC1)C(=O)O |
| InChI | InChI=1S/C18H23N3O4/c1-11(2)15(17(23)24)20-16(22)12-7-9-21(10-8-12)18-19-13-5-3-4-6-14(13)25-18/h3-6,11-12,15H,7-10H2,1-2H3,(H,20,22)(H,23,24)/t15-/m0/s1 |
| InChIKey | HWPUPBZFBZQEOL-HNNXBMFYSA-N |
| XLogP | 2.27 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-[[1-(1,3-benzoxazol-2-yl)piperidine-4-carbonyl]amino]-3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[1-(1,3-benzoxazol-2-yl)piperidine-4-carbonyl]amino]-3-methylbutanoic acid?
The IUPAC name of (2S)-2-[[1-(1,3-benzoxazol-2-yl)piperidine-4-carbonyl]amino]-3-methylbutanoic acid (CID 119359710) is (2S)-2-[[1-(1,3-benzoxazol-2-yl)piperidine-4-carbonyl]amino]-3-methylbutanoic acid.
What is the SMILES notation for (2S)-2-[[1-(1,3-benzoxazol-2-yl)piperidine-4-carbonyl]amino]-3-methylbutanoic acid?
The canonical SMILES for (2S)-2-[[1-(1,3-benzoxazol-2-yl)piperidine-4-carbonyl]amino]-3-methylbutanoic acid is CC(C)[C@H](NC(=O)C1CCN(c2nc3ccccc3o2)CC1)C(=O)O.
What is the InChIKey of (2S)-2-[[1-(1,3-benzoxazol-2-yl)piperidine-4-carbonyl]amino]-3-methylbutanoic acid?
The InChIKey is HWPUPBZFBZQEOL-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H23N3O4/c1-11(2)15(17(23)24)20-16(22)12-7-9-21(10-8-12)18-19-13-5-3-4-6-14(13)25-18/h3-6,11-12,15H,7-10H2,1-2H3,(H,20,22)(H,23,24)/t15-/m0/s1.
What are the key properties of (2S)-2-[[1-(1,3-benzoxazol-2-yl)piperidine-4-carbonyl]amino]-3-methylbutanoic acid?
(2S)-2-[[1-(1,3-benzoxazol-2-yl)piperidine-4-carbonyl]amino]-3-methylbutanoic acid has a molecular weight of 345.40 g/mol, XLogP of 2.27, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[1-(1,3-benzoxazol-2-yl)piperidine-4-carbonyl]amino]-3-methylbutanoic acid is sourced from PubChem (CID 119359710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).