C12H11F4NO3 — CID 119362318
3-[[3-fluoro-5-(trifluoromethyl)benzoyl]-methylamino]propanoic acid (PubChem CID 119362318) has the molecular formula C12H11F4NO3 and a molecular weight of 293.22 g/mol. Its IUPAC name is 3-[[3-fluoro-5-(trifluoromethyl)benzoyl]-methylamino]propanoic acid.
| Compound Name | 3-[[3-fluoro-5-(trifluoromethyl)benzoyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 119362318 |
| Molecular Formula | C12H11F4NO3 |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-[[3-fluoro-5-(trifluoromethyl)benzoyl]-methylamino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F4NO3/c1-17(3-2-10(18)19)11(20)7-4-8(12(14,15)16)6-9(13)5-7/h4-6H,2-3H2,1H3,(H,18,19) |
| InChIKey | RRASDUBLPSWPSZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |