C16H23ClN2O3 — CID 119363158
(2R)-2-[[2-(3-chlorophenyl)-2-(dimethylamino)acetyl]amino]-4-methylpentanoic acid (PubChem CID 119363158) has the molecular formula C16H23ClN2O3 and a molecular weight of 326.82 g/mol. Its IUPAC name is (2R)-2-[[2-(3-chlorophenyl)-2-(dimethylamino)acetyl]amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[2-(3-chlorophenyl)-2-(dimethylamino)acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119363158 |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (2R)-2-[[2-(3-chlorophenyl)-2-(dimethylamino)acetyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)C(c1cccc(Cl)c1)N(C)C)C(=O)O |
| InChI | InChI=1S/C16H23ClN2O3/c1-10(2)8-13(16(21)22)18-15(20)14(19(3)4)11-6-5-7-12(17)9-11/h5-7,9-10,13-14H,8H2,1-4H3,(H,18,20)(H,21,22)/t13-,14?/m1/s1 |
| InChIKey | AVIVBVYIZHCPLH-KWCCSABGSA-N |
| XLogP | 2.56 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |