C17H20N2O6S — CID 119367357
(2R)-2-[[4-(dimethylsulfamoyl)-5-methylfuran-2-carbonyl]amino]-3-phenylpropanoic acid (PubChem CID 119367357) has the molecular formula C17H20N2O6S and a molecular weight of 380.42 g/mol. Its IUPAC name is (2R)-2-[[4-(dimethylsulfamoyl)-5-methylfuran-2-carbonyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[4-(dimethylsulfamoyl)-5-methylfuran-2-carbonyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 119367357 |
| Molecular Formula | C17H20N2O6S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | (2R)-2-[[4-(dimethylsulfamoyl)-5-methylfuran-2-carbonyl]amino]-3-phenylpropanoic acid |
| SMILES | Cc1oc(C(=O)N[C@H](Cc2ccccc2)C(=O)O)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C17H20N2O6S/c1-11-15(26(23,24)19(2)3)10-14(25-11)16(20)18-13(17(21)22)9-12-7-5-4-6-8-12/h4-8,10,13H,9H2,1-3H3,(H,18,20)(H,21,22)/t13-/m1/s1 |
| InChIKey | FQLFSCOIHIJFKC-CYBMUJFWSA-N |
| XLogP | 1.26 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |