C14H22N2O6S — CID 119361847
(2S)-2-[[4-(dimethylsulfamoyl)-5-methylfuran-2-carbonyl]amino]-4-methylpentanoic acid (PubChem CID 119361847) has the molecular formula C14H22N2O6S and a molecular weight of 346.41 g/mol. Its IUPAC name is (2S)-2-[[4-(dimethylsulfamoyl)-5-methylfuran-2-carbonyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[4-(dimethylsulfamoyl)-5-methylfuran-2-carbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119361847 |
| Molecular Formula | C14H22N2O6S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (2S)-2-[[4-(dimethylsulfamoyl)-5-methylfuran-2-carbonyl]amino]-4-methylpentanoic acid |
| SMILES | Cc1oc(C(=O)N[C@@H](CC(C)C)C(=O)O)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C14H22N2O6S/c1-8(2)6-10(14(18)19)15-13(17)11-7-12(9(3)22-11)23(20,21)16(4)5/h7-8,10H,6H2,1-5H3,(H,15,17)(H,18,19)/t10-/m0/s1 |
| InChIKey | WKLVYELLVZZQJM-JTQLQIEISA-N |
| XLogP | 1.07 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |