C18H24N4O3 — CID 119370297
(2R)-2-[[1-(3-propan-2-ylphenyl)-5-propyltriazole-4-carbonyl]amino]propanoic acid (PubChem CID 119370297) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is (2R)-2-[[1-(3-propan-2-ylphenyl)-5-propyltriazole-4-carbonyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[1-(3-propan-2-ylphenyl)-5-propyltriazole-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119370297 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (2R)-2-[[1-(3-propan-2-ylphenyl)-5-propyltriazole-4-carbonyl]amino]propanoic acid |
| SMILES | CCCc1c(C(=O)N[C@H](C)C(=O)O)nnn1-c1cccc(C(C)C)c1 |
| InChI | InChI=1S/C18H24N4O3/c1-5-7-15-16(17(23)19-12(4)18(24)25)20-21-22(15)14-9-6-8-13(10-14)11(2)3/h6,8-12H,5,7H2,1-4H3,(H,19,23)(H,24,25)/t12-/m1/s1 |
| InChIKey | ZIBSTOLEOUBGLQ-GFCCVEGCSA-N |
| XLogP | 2.55 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |