C16H22ClN5O — CID 119995437
N-(3-amino-2-methylpropyl)-1-(3-chlorophenyl)-5-propyltriazole-4-carboxamide (PubChem CID 119995437) has the molecular formula C16H22ClN5O and a molecular weight of 335.84 g/mol. Its IUPAC name is N-(3-amino-2-methylpropyl)-1-(3-chlorophenyl)-5-propyltriazole-4-carboxamide.
| Compound Name | N-(3-amino-2-methylpropyl)-1-(3-chlorophenyl)-5-propyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119995437 |
| Molecular Formula | C16H22ClN5O |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N-(3-amino-2-methylpropyl)-1-(3-chlorophenyl)-5-propyltriazole-4-carboxamide |
| SMILES | CCCc1c(C(=O)NCC(C)CN)nnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H22ClN5O/c1-3-5-14-15(16(23)19-10-11(2)9-18)20-21-22(14)13-7-4-6-12(17)8-13/h4,6-8,11H,3,5,9-10,18H2,1-2H3,(H,19,23) |
| InChIKey | YXDYWSRURYMPCV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |