C21H27F2N3O2 — CID 119376379
(4-aminopiperidin-1-yl)-[1-(2,4-difluorobenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]methanone (PubChem CID 119376379) has the molecular formula C21H27F2N3O2 and a molecular weight of 391.46 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-[1-(2,4-difluorobenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]methanone.
| Compound Name | (4-aminopiperidin-1-yl)-[1-(2,4-difluorobenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]methanone |
|---|---|
| PubChem CID | 119376379 |
| Molecular Formula | C21H27F2N3O2 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (4-aminopiperidin-1-yl)-[1-(2,4-difluorobenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]methanone |
| SMILES | NC1CCN(C(=O)C2CC3CCCCC3N2C(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C21H27F2N3O2/c22-14-5-6-16(17(23)12-14)20(27)26-18-4-2-1-3-13(18)11-19(26)21(28)25-9-7-15(24)8-10-25/h5-6,12-13,15,18-19H,1-4,7-11,24H2 |
| InChIKey | QAODJKIZCGPESN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |