C10H20ClN3O2 — CID 119377596
3-(3-aminopiperidin-1-yl)-N,N-dimethyl-3-oxopropanamide;hydrochloride (PubChem CID 119377596) has the molecular formula C10H20ClN3O2 and a molecular weight of 249.74 g/mol. Its IUPAC name is 3-(3-aminopiperidin-1-yl)-N,N-dimethyl-3-oxopropanamide;hydrochloride.
| Compound Name | 3-(3-aminopiperidin-1-yl)-N,N-dimethyl-3-oxopropanamide;hydrochloride |
|---|---|
| PubChem CID | 119377596 |
| Molecular Formula | C10H20ClN3O2 |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 3-(3-aminopiperidin-1-yl)-N,N-dimethyl-3-oxopropanamide;hydrochloride |
| SMILES | CN(C)C(=O)CC(=O)N1CCCC(N)C1.Cl |
| InChI | InChI=1S/C10H19N3O2.ClH/c1-12(2)9(14)6-10(15)13-5-3-4-8(11)7-13;/h8H,3-7,11H2,1-2H3;1H |
| InChIKey | FNBGKXMFWKGOOJ-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|