C17H27ClN2O3S2 — CID 119387404
N-piperidin-4-yl-2-(2-propylsulfonylphenyl)sulfanylpropanamide;hydrochloride (PubChem CID 119387404) has the molecular formula C17H27ClN2O3S2 and a molecular weight of 407.00 g/mol. Its IUPAC name is N-piperidin-4-yl-2-(2-propylsulfonylphenyl)sulfanylpropanamide;hydrochloride.
| Compound Name | N-piperidin-4-yl-2-(2-propylsulfonylphenyl)sulfanylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119387404 |
| Molecular Formula | C17H27ClN2O3S2 |
| Molecular Weight | 407.00 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-piperidin-4-yl-2-(2-propylsulfonylphenyl)sulfanylpropanamide;hydrochloride |
| SMILES | CCCS(=O)(=O)c1ccccc1SC(C)C(=O)NC1CCNCC1.Cl |
| InChI | InChI=1S/C17H26N2O3S2.ClH/c1-3-12-24(21,22)16-7-5-4-6-15(16)23-13(2)17(20)19-14-8-10-18-11-9-14;/h4-7,13-14,18H,3,8-12H2,1-2H3,(H,19,20);1H |
| InChIKey | RRKOOLAOGJSDFW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.00 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |