C18H28N2O3S2 — CID 119442348
N-methyl-N-piperidin-4-yl-2-(2-propylsulfonylphenyl)sulfanylpropanamide (PubChem CID 119442348) has the molecular formula C18H28N2O3S2 and a molecular weight of 384.57 g/mol. Its IUPAC name is N-methyl-N-piperidin-4-yl-2-(2-propylsulfonylphenyl)sulfanylpropanamide.
| Compound Name | N-methyl-N-piperidin-4-yl-2-(2-propylsulfonylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 119442348 |
| Molecular Formula | C18H28N2O3S2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-methyl-N-piperidin-4-yl-2-(2-propylsulfonylphenyl)sulfanylpropanamide |
| SMILES | CCCS(=O)(=O)c1ccccc1SC(C)C(=O)N(C)C1CCNCC1 |
| InChI | InChI=1S/C18H28N2O3S2/c1-4-13-25(22,23)17-8-6-5-7-16(17)24-14(2)18(21)20(3)15-9-11-19-12-10-15/h5-8,14-15,19H,4,9-13H2,1-3H3 |
| InChIKey | ICAZZBNRZKSXSG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |