C16H26N2O3S2 — CID 119627451
N-(2-amino-2-methylpropyl)-2-(2-propylsulfonylphenyl)sulfanylpropanamide (PubChem CID 119627451) has the molecular formula C16H26N2O3S2 and a molecular weight of 358.53 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-2-(2-propylsulfonylphenyl)sulfanylpropanamide.
| Compound Name | N-(2-amino-2-methylpropyl)-2-(2-propylsulfonylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 119627451 |
| Molecular Formula | C16H26N2O3S2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-2-(2-propylsulfonylphenyl)sulfanylpropanamide |
| SMILES | CCCS(=O)(=O)c1ccccc1SC(C)C(=O)NCC(C)(C)N |
| InChI | InChI=1S/C16H26N2O3S2/c1-5-10-23(20,21)14-9-7-6-8-13(14)22-12(2)15(19)18-11-16(3,4)17/h6-9,12H,5,10-11,17H2,1-4H3,(H,18,19) |
| InChIKey | NIZHPDGJUKELFM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |