C16H27ClN2O3S2 — CID 119431118
N-[3-(methylamino)propyl]-2-(2-propylsulfonylphenyl)sulfanylpropanamide;hydrochloride (PubChem CID 119431118) has the molecular formula C16H27ClN2O3S2 and a molecular weight of 394.99 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]-2-(2-propylsulfonylphenyl)sulfanylpropanamide;hydrochloride.
| Compound Name | N-[3-(methylamino)propyl]-2-(2-propylsulfonylphenyl)sulfanylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119431118 |
| Molecular Formula | C16H27ClN2O3S2 |
| Molecular Weight | 394.99 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N-[3-(methylamino)propyl]-2-(2-propylsulfonylphenyl)sulfanylpropanamide;hydrochloride |
| SMILES | CCCS(=O)(=O)c1ccccc1SC(C)C(=O)NCCCNC.Cl |
| InChI | InChI=1S/C16H26N2O3S2.ClH/c1-4-12-23(20,21)15-9-6-5-8-14(15)22-13(2)16(19)18-11-7-10-17-3;/h5-6,8-9,13,17H,4,7,10-12H2,1-3H3,(H,18,19);1H |
| InChIKey | CGUSHPDRXAPFEW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.99 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|