C19H20F2N2OS — CID 119389227
2-(2,4-difluorophenyl)sulfanyl-2-phenyl-N-piperidin-4-ylacetamide (PubChem CID 119389227) has the molecular formula C19H20F2N2OS and a molecular weight of 362.45 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfanyl-2-phenyl-N-piperidin-4-ylacetamide.
| Compound Name | 2-(2,4-difluorophenyl)sulfanyl-2-phenyl-N-piperidin-4-ylacetamide |
|---|---|
| PubChem CID | 119389227 |
| Molecular Formula | C19H20F2N2OS |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-(2,4-difluorophenyl)sulfanyl-2-phenyl-N-piperidin-4-ylacetamide |
| SMILES | O=C(NC1CCNCC1)C(Sc1ccc(F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C19H20F2N2OS/c20-14-6-7-17(16(21)12-14)25-18(13-4-2-1-3-5-13)19(24)23-15-8-10-22-11-9-15/h1-7,12,15,18,22H,8-11H2,(H,23,24) |
| InChIKey | PRLSZESIIHNQPZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |