C21H24F2N2OS — CID 119558315
2-(2,4-difluorophenyl)sulfanyl-2-phenyl-N-(2-piperidin-3-ylethyl)acetamide (PubChem CID 119558315) has the molecular formula C21H24F2N2OS and a molecular weight of 390.50 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfanyl-2-phenyl-N-(2-piperidin-3-ylethyl)acetamide.
| Compound Name | 2-(2,4-difluorophenyl)sulfanyl-2-phenyl-N-(2-piperidin-3-ylethyl)acetamide |
|---|---|
| PubChem CID | 119558315 |
| Molecular Formula | C21H24F2N2OS |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2-(2,4-difluorophenyl)sulfanyl-2-phenyl-N-(2-piperidin-3-ylethyl)acetamide |
| SMILES | O=C(NCCC1CCCNC1)C(Sc1ccc(F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C21H24F2N2OS/c22-17-8-9-19(18(23)13-17)27-20(16-6-2-1-3-7-16)21(26)25-12-10-15-5-4-11-24-14-15/h1-3,6-9,13,15,20,24H,4-5,10-12,14H2,(H,25,26) |
| InChIKey | IJMAULHCAXGQDZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |