C18H18F2N2OS — CID 119402882
2-(2,4-difluorophenyl)sulfanyl-2-phenyl-1-piperazin-1-ylethanone (PubChem CID 119402882) has the molecular formula C18H18F2N2OS and a molecular weight of 348.42 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfanyl-2-phenyl-1-piperazin-1-ylethanone.
| Compound Name | 2-(2,4-difluorophenyl)sulfanyl-2-phenyl-1-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 119402882 |
| Molecular Formula | C18H18F2N2OS |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-(2,4-difluorophenyl)sulfanyl-2-phenyl-1-piperazin-1-ylethanone |
| SMILES | O=C(C(Sc1ccc(F)cc1F)c1ccccc1)N1CCNCC1 |
| InChI | InChI=1S/C18H18F2N2OS/c19-14-6-7-16(15(20)12-14)24-17(13-4-2-1-3-5-13)18(23)22-10-8-21-9-11-22/h1-7,12,17,21H,8-11H2 |
| InChIKey | HNDMYVDZOCVLGS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |