C19H27N5O2 — CID 119390482
5-ethyl-N-piperidin-4-yl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide (PubChem CID 119390482) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 5-ethyl-N-piperidin-4-yl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide.
| Compound Name | 5-ethyl-N-piperidin-4-yl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 119390482 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 5-ethyl-N-piperidin-4-yl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide |
| SMILES | CCc1c(C(=O)NC2CCNCC2)nnn1-c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C19H27N5O2/c1-4-17-18(19(25)21-14-9-11-20-12-10-14)22-23-24(17)15-5-7-16(8-6-15)26-13(2)3/h5-8,13-14,20H,4,9-12H2,1-3H3,(H,21,25) |
| InChIKey | WWWKXCHKBLXBHA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |