C20H31N5O2 — CID 119668831
N-(1-aminohexan-2-yl)-5-ethyl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide (PubChem CID 119668831) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-5-ethyl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide.
| Compound Name | N-(1-aminohexan-2-yl)-5-ethyl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 119668831 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | N-(1-aminohexan-2-yl)-5-ethyl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide |
| SMILES | CCCCC(CN)NC(=O)c1nnn(-c2ccc(OC(C)C)cc2)c1CC |
| InChI | InChI=1S/C20H31N5O2/c1-5-7-8-15(13-21)22-20(26)19-18(6-2)25(24-23-19)16-9-11-17(12-10-16)27-14(3)4/h9-12,14-15H,5-8,13,21H2,1-4H3,(H,22,26) |
| InChIKey | AMUBVSYUDPVDPP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |