C22H28ClN5O2 — CID 119549755
N-[2-(4-aminophenyl)ethyl]-5-ethyl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide;hydrochloride (PubChem CID 119549755) has the molecular formula C22H28ClN5O2 and a molecular weight of 429.95 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-5-ethyl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-5-ethyl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119549755 |
| Molecular Formula | C22H28ClN5O2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-5-ethyl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxamide;hydrochloride |
| SMILES | CCc1c(C(=O)NCCc2ccc(N)cc2)nnn1-c1ccc(OC(C)C)cc1.Cl |
| InChI | InChI=1S/C22H27N5O2.ClH/c1-4-20-21(22(28)24-14-13-16-5-7-17(23)8-6-16)25-26-27(20)18-9-11-19(12-10-18)29-15(2)3;/h5-12,15H,4,13-14,23H2,1-3H3,(H,24,28);1H |
| InChIKey | PSQXXEXWKIEGML-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|